About 3-cyclohexa-1,3-dien-1-yloxy-N,N-dimethylpropan-1-amine
3-cyclohexa-1,3-dien-1-yloxy-N,N-dimethylpropan-1-amine (PubChem CID 155381623) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is 3-cyclohexa-1,3-dien-1-yloxy-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-cyclohexa-1,3-dien-1-yloxy-N,N-dimethylpropan-1-amine |
| PubChem CID | 155381623 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 3-cyclohexa-1,3-dien-1-yloxy-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCOC1=CC=CCC1 |
| InChI | InChI=1S/C11H19NO/c1-12(2)9-6-10-13-11-7-4-3-5-8-11/h3-4,7H,5-6,8-10H2,1-2H3 |
| InChIKey | BOPUPLVUWHQHMK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclohexa-1,3-dien-1-yloxy-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexa-1,3-dien-1-yloxy-N,N-dimethylpropan-1-amine?
The IUPAC name of 3-cyclohexa-1,3-dien-1-yloxy-N,N-dimethylpropan-1-amine (CID 155381623) is 3-cyclohexa-1,3-dien-1-yloxy-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 3-cyclohexa-1,3-dien-1-yloxy-N,N-dimethylpropan-1-amine?
The canonical SMILES for 3-cyclohexa-1,3-dien-1-yloxy-N,N-dimethylpropan-1-amine is CN(C)CCCOC1=CC=CCC1.
What is the InChIKey of 3-cyclohexa-1,3-dien-1-yloxy-N,N-dimethylpropan-1-amine?
The InChIKey is BOPUPLVUWHQHMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO/c1-12(2)9-6-10-13-11-7-4-3-5-8-11/h3-4,7H,5-6,8-10H2,1-2H3.
What are the key properties of 3-cyclohexa-1,3-dien-1-yloxy-N,N-dimethylpropan-1-amine?
3-cyclohexa-1,3-dien-1-yloxy-N,N-dimethylpropan-1-amine has a molecular weight of 181.28 g/mol, XLogP of 2.19, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexa-1,3-dien-1-yloxy-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 155381623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).