About (E)-N-(3-ethenyl-1,2,4-triazol-4-yl)-3-methylbutan-2-imine
(E)-N-(3-ethenyl-1,2,4-triazol-4-yl)-3-methylbutan-2-imine (PubChem CID 155382112) has the molecular formula C9H14N4
and a molecular weight of 178.24 g/mol. Its IUPAC name is (E)-N-(3-ethenyl-1,2,4-triazol-4-yl)-3-methylbutan-2-imine.
Molecular Properties
| Compound Name | (E)-N-(3-ethenyl-1,2,4-triazol-4-yl)-3-methylbutan-2-imine |
| PubChem CID | 155382112 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | (E)-N-(3-ethenyl-1,2,4-triazol-4-yl)-3-methylbutan-2-imine |
| SMILES | C=Cc1nncn1/N=C(\C)C(C)C |
| InChI | InChI=1S/C9H14N4/c1-5-9-11-10-6-13(9)12-8(4)7(2)3/h5-7H,1H2,2-4H3/b12-8+ |
| InChIKey | SCBXDMWNWAXRLR-XYOKQWHBSA-N |
| XLogP | 1.80 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-(3-ethenyl-1,2,4-triazol-4-yl)-3-methylbutan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-(3-ethenyl-1,2,4-triazol-4-yl)-3-methylbutan-2-imine?
The IUPAC name of (E)-N-(3-ethenyl-1,2,4-triazol-4-yl)-3-methylbutan-2-imine (CID 155382112) is (E)-N-(3-ethenyl-1,2,4-triazol-4-yl)-3-methylbutan-2-imine.
What is the SMILES notation for (E)-N-(3-ethenyl-1,2,4-triazol-4-yl)-3-methylbutan-2-imine?
The canonical SMILES for (E)-N-(3-ethenyl-1,2,4-triazol-4-yl)-3-methylbutan-2-imine is C=Cc1nncn1/N=C(\C)C(C)C.
What is the InChIKey of (E)-N-(3-ethenyl-1,2,4-triazol-4-yl)-3-methylbutan-2-imine?
The InChIKey is SCBXDMWNWAXRLR-XYOKQWHBSA-N. The full InChI is InChI=1S/C9H14N4/c1-5-9-11-10-6-13(9)12-8(4)7(2)3/h5-7H,1H2,2-4H3/b12-8+.
What are the key properties of (E)-N-(3-ethenyl-1,2,4-triazol-4-yl)-3-methylbutan-2-imine?
(E)-N-(3-ethenyl-1,2,4-triazol-4-yl)-3-methylbutan-2-imine has a molecular weight of 178.24 g/mol, XLogP of 1.80, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-(3-ethenyl-1,2,4-triazol-4-yl)-3-methylbutan-2-imine is sourced from PubChem (CID 155382112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).