About 6-amino-2-iodo-3,4-dimethoxybenzonitrile
6-amino-2-iodo-3,4-dimethoxybenzonitrile (PubChem CID 15538284) has the molecular formula C9H9IN2O2
and a molecular weight of 304.09 g/mol. Its IUPAC name is 6-amino-2-iodo-3,4-dimethoxybenzonitrile.
Molecular Properties
| Compound Name | 6-amino-2-iodo-3,4-dimethoxybenzonitrile |
| PubChem CID | 15538284 |
| Molecular Formula | C9H9IN2O2 |
| Molecular Weight | 304.09 g/mol |
| Exact Mass | 303.97 |
| IUPAC Name | 6-amino-2-iodo-3,4-dimethoxybenzonitrile |
| SMILES | COc1cc(N)c(C#N)c(I)c1OC |
| InChI | InChI=1S/C9H9IN2O2/c1-13-7-3-6(12)5(4-11)8(10)9(7)14-2/h3H,12H2,1-2H3 |
| InChIKey | LFSYMBZTFIVRSE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.09 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-2-iodo-3,4-dimethoxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-2-iodo-3,4-dimethoxybenzonitrile?
The IUPAC name of 6-amino-2-iodo-3,4-dimethoxybenzonitrile (CID 15538284) is 6-amino-2-iodo-3,4-dimethoxybenzonitrile.
What is the SMILES notation for 6-amino-2-iodo-3,4-dimethoxybenzonitrile?
The canonical SMILES for 6-amino-2-iodo-3,4-dimethoxybenzonitrile is COc1cc(N)c(C#N)c(I)c1OC.
What is the InChIKey of 6-amino-2-iodo-3,4-dimethoxybenzonitrile?
The InChIKey is LFSYMBZTFIVRSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9IN2O2/c1-13-7-3-6(12)5(4-11)8(10)9(7)14-2/h3H,12H2,1-2H3.
What are the key properties of 6-amino-2-iodo-3,4-dimethoxybenzonitrile?
6-amino-2-iodo-3,4-dimethoxybenzonitrile has a molecular weight of 304.09 g/mol, XLogP of 1.76, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2-iodo-3,4-dimethoxybenzonitrile is sourced from PubChem (CID 15538284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).