C27H29ClF3N7O3S2 — CID 155382947
2-[[(3R,6S)-3-(2-chloro-4-fluorophenyl)-4-[1-(difluoromethyl)pyrazol-3-yl]-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]sulfamoylamino]heptan-4-one (PubChem CID 155382947) has the molecular formula C27H29ClF3N7O3S2 and a molecular weight of 656.16 g/mol. Its IUPAC name is 2-[[(3R,6S)-3-(2-chloro-4-fluorophenyl)-4-[1-(difluoromethyl)pyrazol-3-yl]-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]sulfamoylamino]heptan-4-one.
| Compound Name | 2-[[(3R,6S)-3-(2-chloro-4-fluorophenyl)-4-[1-(difluoromethyl)pyrazol-3-yl]-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]sulfamoylamino]heptan-4-one |
|---|---|
| PubChem CID | 155382947 |
| Molecular Formula | C27H29ClF3N7O3S2 |
| Molecular Weight | 656.16 g/mol |
| Exact Mass | 655.14 |
| IUPAC Name | 2-[[(3R,6S)-3-(2-chloro-4-fluorophenyl)-4-[1-(difluoromethyl)pyrazol-3-yl]-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]sulfamoylamino]heptan-4-one |
| SMILES | CCCC(=O)CC(C)NS(=O)(=O)N[C@H]1CC2=C(c3ccn(C(F)F)n3)[C@H](c3ccc(F)cc3Cl)N=C(c3nccs3)N2C1 |
| InChI | InChI=1S/C27H29ClF3N7O3S2/c1-3-4-18(39)11-15(2)35-43(40,41)36-17-13-22-23(21-7-9-38(34-21)27(30)31)24(19-6-5-16(29)12-20(19)28)33-25(37(22)14-17)26-32-8-10-42-26/h5-10,12,15,17,24,27,35-36H,3-4,11,13-14H2,1-2H3/t15?,17-,24-/m0/s1 |
| InChIKey | VEBYYXZVCNBPAT-ZMTBRMMDSA-N |
| XLogP | 5.09 |
| TPSA | 121.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.16 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |