C11H14F4O4 — CID 155383250
4-(1-ethylcyclopentyl)oxy-2,2,3,3-tetrafluoro-4-oxobutanoic acid (PubChem CID 155383250) has the molecular formula C11H14F4O4 and a molecular weight of 286.22 g/mol. Its IUPAC name is 4-(1-ethylcyclopentyl)oxy-2,2,3,3-tetrafluoro-4-oxobutanoic acid.
| Compound Name | 4-(1-ethylcyclopentyl)oxy-2,2,3,3-tetrafluoro-4-oxobutanoic acid |
|---|---|
| PubChem CID | 155383250 |
| Molecular Formula | C11H14F4O4 |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 4-(1-ethylcyclopentyl)oxy-2,2,3,3-tetrafluoro-4-oxobutanoic acid |
| SMILES | CCC1(OC(=O)C(F)(F)C(F)(F)C(=O)O)CCCC1 |
| InChI | InChI=1S/C11H14F4O4/c1-2-9(5-3-4-6-9)19-8(18)11(14,15)10(12,13)7(16)17/h2-6H2,1H3,(H,16,17) |
| InChIKey | MSOKEGNLMFMIIT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|