C33H32FN3O9 — CID 155383942
(2S,3S,4S,5R,6R)-6-[[3-(4-carboxyphenyl)-1-(4-fluorophenyl)-6-methanimidoyl-2-(oxan-4-yl)indol-5-yl]amino]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 155383942) has the molecular formula C33H32FN3O9 and a molecular weight of 633.63 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-6-[[3-(4-carboxyphenyl)-1-(4-fluorophenyl)-6-methanimidoyl-2-(oxan-4-yl)indol-5-yl]amino]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6R)-6-[[3-(4-carboxyphenyl)-1-(4-fluorophenyl)-6-methanimidoyl-2-(oxan-4-yl)indol-5-yl]amino]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 155383942 |
| Molecular Formula | C33H32FN3O9 |
| Molecular Weight | 633.63 g/mol |
| Exact Mass | 633.21 |
| IUPAC Name | (2S,3S,4S,5R,6R)-6-[[3-(4-carboxyphenyl)-1-(4-fluorophenyl)-6-methanimidoyl-2-(oxan-4-yl)indol-5-yl]amino]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | [H]/N=C\c1cc2c(cc1N[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O)c(-c1ccc(C(=O)O)cc1)c(C1CCOCC1)n2-c1ccc(F)cc1 |
| InChI | InChI=1S/C33H32FN3O9/c34-20-5-7-21(8-6-20)37-24-13-19(15-35)23(36-31-29(40)27(38)28(39)30(46-31)33(43)44)14-22(24)25(26(37)17-9-11-45-12-10-17)16-1-3-18(4-2-16)32(41)42/h1-8,13-15,17,27-31,35-36,38-40H,9-12H2,(H,41,42)(H,43,44)/b35-15-/t27-,28-,29+,30-,31+/m0/s1 |
| InChIKey | ZKIYHAUUUVGFNB-MWERLOMPSA-N |
| XLogP | 3.33 |
| TPSA | 194.56 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.63 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|