C21H30O6 — CID 155384317
2-phenylethyl (E,6R)-6-[(3R,6S)-3,5-dihydroxy-6-methyloxan-2-yl]oxyhept-2-enoate (PubChem CID 155384317) has the molecular formula C21H30O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is 2-phenylethyl (E,6R)-6-[(3R,6S)-3,5-dihydroxy-6-methyloxan-2-yl]oxyhept-2-enoate.
| Compound Name | 2-phenylethyl (E,6R)-6-[(3R,6S)-3,5-dihydroxy-6-methyloxan-2-yl]oxyhept-2-enoate |
|---|---|
| PubChem CID | 155384317 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 2-phenylethyl (E,6R)-6-[(3R,6S)-3,5-dihydroxy-6-methyloxan-2-yl]oxyhept-2-enoate |
| SMILES | C[C@H](CC/C=C/C(=O)OCCc1ccccc1)OC1O[C@@H](C)C(O)C[C@H]1O |
| InChI | InChI=1S/C21H30O6/c1-15(26-21-19(23)14-18(22)16(2)27-21)8-6-7-11-20(24)25-13-12-17-9-4-3-5-10-17/h3-5,7,9-11,15-16,18-19,21-23H,6,8,12-14H2,1-2H3/b11-7+/t15-,16+,18?,19-,21?/m1/s1 |
| InChIKey | CZKWOPAIWFJZHF-ZNSVHOBPSA-N |
| XLogP | 2.37 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|