C17H28O6 — CID 155384332
ethyl (2S,3R)-3-[(3S)-3-[(2R,3R,5R,6S)-5-hydroxy-3,6-dimethyloxan-2-yl]oxypent-4-enyl]oxirane-2-carboxylate (PubChem CID 155384332) has the molecular formula C17H28O6 and a molecular weight of 328.41 g/mol. Its IUPAC name is ethyl (2S,3R)-3-[(3S)-3-[(2R,3R,5R,6S)-5-hydroxy-3,6-dimethyloxan-2-yl]oxypent-4-enyl]oxirane-2-carboxylate.
| Compound Name | ethyl (2S,3R)-3-[(3S)-3-[(2R,3R,5R,6S)-5-hydroxy-3,6-dimethyloxan-2-yl]oxypent-4-enyl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 155384332 |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | ethyl (2S,3R)-3-[(3S)-3-[(2R,3R,5R,6S)-5-hydroxy-3,6-dimethyloxan-2-yl]oxypent-4-enyl]oxirane-2-carboxylate |
| SMILES | C=C[C@H](CC[C@H]1O[C@@H]1C(=O)OCC)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1C |
| InChI | InChI=1S/C17H28O6/c1-5-12(7-8-14-15(23-14)16(19)20-6-2)22-17-10(3)9-13(18)11(4)21-17/h5,10-15,17-18H,1,6-9H2,2-4H3/t10-,11+,12-,13-,14-,15+,17+/m1/s1 |
| InChIKey | JLJZDMRHFWFVML-MRIZRFMCSA-N |
| XLogP | 1.80 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|