C16H17N7 — CID 155384582
5-methyl-6-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-2-carbonitrile (PubChem CID 155384582) has the molecular formula C16H17N7 and a molecular weight of 307.36 g/mol. Its IUPAC name is 5-methyl-6-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-2-carbonitrile.
| Compound Name | 5-methyl-6-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 155384582 |
| Molecular Formula | C16H17N7 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 5-methyl-6-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-2-carbonitrile |
| SMILES | CC1Cc2cc(C#N)nn2CC1N(C)c1ncnc2[nH]ccc12 |
| InChI | InChI=1S/C16H17N7/c1-10-5-12-6-11(7-17)21-23(12)8-14(10)22(2)16-13-3-4-18-15(13)19-9-20-16/h3-4,6,9-10,14H,5,8H2,1-2H3,(H,18,19,20) |
| InChIKey | GNCXJZJFSWOYMO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 86.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |