C30H54N4O9 — CID 155384596
prop-2-enyl (2S)-2-[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 155384596) has the molecular formula C30H54N4O9 and a molecular weight of 614.78 g/mol. Its IUPAC name is prop-2-enyl (2S)-2-[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | prop-2-enyl (2S)-2-[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 155384596 |
| Molecular Formula | C30H54N4O9 |
| Molecular Weight | 614.78 g/mol |
| Exact Mass | 614.39 |
| IUPAC Name | prop-2-enyl (2S)-2-[2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoylamino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | C=CCOC(=O)[C@H](CCCCNC(=O)OC(C)(C)C)NC(=O)C(CCCCNC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H54N4O9/c1-11-20-40-24(36)22(17-13-15-19-32-26(38)42-29(5,6)7)33-23(35)21(34-27(39)43-30(8,9)10)16-12-14-18-31-25(37)41-28(2,3)4/h11,21-22H,1,12-20H2,2-10H3,(H,31,37)(H,32,38)(H,33,35)(H,34,39)/t21?,22-/m0/s1 |
| InChIKey | UHYQRFDVUULYFF-KEKNWZKVSA-N |
| XLogP | 4.48 |
| TPSA | 170.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.78 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|