C28H27ClN4O5 — CID 155384694
1-[2-chloro-4-[[5-(3-pyrrol-1-ylpropoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-yl]oxy]phenyl]-3-cyclopropylurea (PubChem CID 155384694) has the molecular formula C28H27ClN4O5 and a molecular weight of 535.00 g/mol. Its IUPAC name is 1-[2-chloro-4-[[5-(3-pyrrol-1-ylpropoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-yl]oxy]phenyl]-3-cyclopropylurea.
| Compound Name | 1-[2-chloro-4-[[5-(3-pyrrol-1-ylpropoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-yl]oxy]phenyl]-3-cyclopropylurea |
|---|---|
| PubChem CID | 155384694 |
| Molecular Formula | C28H27ClN4O5 |
| Molecular Weight | 535.00 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | 1-[2-chloro-4-[[5-(3-pyrrol-1-ylpropoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-yl]oxy]phenyl]-3-cyclopropylurea |
| SMILES | O=C(Nc1ccc(Oc2ccnc3cc(OCCCn4cccc4)c4c(c23)OCCO4)cc1Cl)NC1CC1 |
| InChI | InChI=1S/C28H27ClN4O5/c29-20-16-19(6-7-21(20)32-28(34)31-18-4-5-18)38-23-8-9-30-22-17-24(26-27(25(22)23)37-15-14-36-26)35-13-3-12-33-10-1-2-11-33/h1-2,6-11,16-18H,3-5,12-15H2,(H2,31,32,34) |
| InChIKey | XCKWBNSCTWOTIC-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 95.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.00 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|