C24H28N2O3 — CID 155384957
(2R)-2-[1-[2-(1H-indol-3-yl)ethyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]propanal (PubChem CID 155384957) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is (2R)-2-[1-[2-(1H-indol-3-yl)ethyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]propanal.
| Compound Name | (2R)-2-[1-[2-(1H-indol-3-yl)ethyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]propanal |
|---|---|
| PubChem CID | 155384957 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | (2R)-2-[1-[2-(1H-indol-3-yl)ethyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]propanal |
| SMILES | COc1cc2c(cc1OC)C(CCc1c[nH]c3ccccc13)N([C@H](C)C=O)CC2 |
| InChI | InChI=1S/C24H28N2O3/c1-16(15-27)26-11-10-17-12-23(28-2)24(29-3)13-20(17)22(26)9-8-18-14-25-21-7-5-4-6-19(18)21/h4-7,12-16,22,25H,8-11H2,1-3H3/t16-,22?/m1/s1 |
| InChIKey | NUGLOOLTFUDCMS-XESZBRCGSA-N |
| XLogP | 4.30 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|