C20H28BrNO5 — CID 155385231
4-O-[(2-bromophenyl)-hydroxymethyl] 1-O-tert-butyl 4-ethylpiperidine-1,4-dicarboxylate (PubChem CID 155385231) has the molecular formula C20H28BrNO5 and a molecular weight of 442.35 g/mol. Its IUPAC name is 4-O-[(2-bromophenyl)-hydroxymethyl] 1-O-tert-butyl 4-ethylpiperidine-1,4-dicarboxylate.
| Compound Name | 4-O-[(2-bromophenyl)-hydroxymethyl] 1-O-tert-butyl 4-ethylpiperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 155385231 |
| Molecular Formula | C20H28BrNO5 |
| Molecular Weight | 442.35 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 4-O-[(2-bromophenyl)-hydroxymethyl] 1-O-tert-butyl 4-ethylpiperidine-1,4-dicarboxylate |
| SMILES | CCC1(C(=O)OC(O)c2ccccc2Br)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H28BrNO5/c1-5-20(10-12-22(13-11-20)18(25)27-19(2,3)4)17(24)26-16(23)14-8-6-7-9-15(14)21/h6-9,16,23H,5,10-13H2,1-4H3 |
| InChIKey | SZBKJLRRFSLHIY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.35 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|