About 7-methoxy-4-methyl-2-(3,4,5-trimethoxyphenyl)chromenylium chloride
7-methoxy-4-methyl-2-(3,4,5-trimethoxyphenyl)chromenylium chloride (PubChem CID 15538540) has the molecular formula C20H21ClO5
and a molecular weight of 376.84 g/mol. Its IUPAC name is 7-methoxy-4-methyl-2-(3,4,5-trimethoxyphenyl)chromenylium chloride.
Molecular Properties
| Compound Name | 7-methoxy-4-methyl-2-(3,4,5-trimethoxyphenyl)chromenylium chloride |
| PubChem CID | 15538540 |
| Molecular Formula | C20H21ClO5 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 7-methoxy-4-methyl-2-(3,4,5-trimethoxyphenyl)chromenylium chloride |
| SMILES | COc1ccc2c(C)cc(-c3cc(OC)c(OC)c(OC)c3)[o+]c2c1.[Cl-] |
| InChI | InChI=1S/C20H21O5.ClH/c1-12-8-16(25-17-11-14(21-2)6-7-15(12)17)13-9-18(22-3)20(24-5)19(10-13)23-4;/h6-11H,1-5H3;1H/q+1;/p-1 |
| InChIKey | ZXQVSYCPQCJQTI-UHFFFAOYSA-M |
| XLogP | 1.73 |
| TPSA | 48.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 7-methoxy-4-methyl-2-(3,4,5-trimethoxyphenyl)chromenylium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-4-methyl-2-(3,4,5-trimethoxyphenyl)chromenylium chloride?
The IUPAC name of 7-methoxy-4-methyl-2-(3,4,5-trimethoxyphenyl)chromenylium chloride (CID 15538540) is 7-methoxy-4-methyl-2-(3,4,5-trimethoxyphenyl)chromenylium chloride.
What is the SMILES notation for 7-methoxy-4-methyl-2-(3,4,5-trimethoxyphenyl)chromenylium chloride?
The canonical SMILES for 7-methoxy-4-methyl-2-(3,4,5-trimethoxyphenyl)chromenylium chloride is COc1ccc2c(C)cc(-c3cc(OC)c(OC)c(OC)c3)[o+]c2c1.[Cl-].
What is the InChIKey of 7-methoxy-4-methyl-2-(3,4,5-trimethoxyphenyl)chromenylium chloride?
The InChIKey is ZXQVSYCPQCJQTI-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H21O5.ClH/c1-12-8-16(25-17-11-14(21-2)6-7-15(12)17)13-9-18(22-3)20(24-5)19(10-13)23-4;/h6-11H,1-5H3;1H/q+1;/p-1.
What are the key properties of 7-methoxy-4-methyl-2-(3,4,5-trimethoxyphenyl)chromenylium chloride?
7-methoxy-4-methyl-2-(3,4,5-trimethoxyphenyl)chromenylium chloride has a molecular weight of 376.84 g/mol, XLogP of 1.73, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-4-methyl-2-(3,4,5-trimethoxyphenyl)chromenylium chloride is sourced from PubChem (CID 15538540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).