C18H16F3N3O — CID 155386051
1-(2-cyclopropyl-2-methoxyethyl)-6-(3,4,5-trifluorophenyl)pyrazolo[4,5-b]pyridine (PubChem CID 155386051) has the molecular formula C18H16F3N3O and a molecular weight of 347.34 g/mol. Its IUPAC name is 1-(2-cyclopropyl-2-methoxyethyl)-6-(3,4,5-trifluorophenyl)pyrazolo[4,5-b]pyridine.
| Compound Name | 1-(2-cyclopropyl-2-methoxyethyl)-6-(3,4,5-trifluorophenyl)pyrazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 155386051 |
| Molecular Formula | C18H16F3N3O |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 1-(2-cyclopropyl-2-methoxyethyl)-6-(3,4,5-trifluorophenyl)pyrazolo[4,5-b]pyridine |
| SMILES | COC(Cn1ncc2ncc(-c3cc(F)c(F)c(F)c3)cc21)C1CC1 |
| InChI | InChI=1S/C18H16F3N3O/c1-25-17(10-2-3-10)9-24-16-6-12(7-22-15(16)8-23-24)11-4-13(19)18(21)14(20)5-11/h4-8,10,17H,2-3,9H2,1H3 |
| InChIKey | RDMKAVGODKFRCD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|