About 6-[[6-[3-(1,1-difluoroethyl)phenyl]pyrazin-2-yl]methyl]-4-oxa-6-azaspiro[2.5]octan-5-one
6-[[6-[3-(1,1-difluoroethyl)phenyl]pyrazin-2-yl]methyl]-4-oxa-6-azaspiro[2.5]octan-5-one (PubChem CID 155386773) has the molecular formula C19H19F2N3O2
and a molecular weight of 359.38 g/mol. Its IUPAC name is 6-[[6-[3-(1,1-difluoroethyl)phenyl]pyrazin-2-yl]methyl]-4-oxa-6-azaspiro[2.5]octan-5-one.
Molecular Properties
| Compound Name | 6-[[6-[3-(1,1-difluoroethyl)phenyl]pyrazin-2-yl]methyl]-4-oxa-6-azaspiro[2.5]octan-5-one |
| PubChem CID | 155386773 |
| Molecular Formula | C19H19F2N3O2 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 6-[[6-[3-(1,1-difluoroethyl)phenyl]pyrazin-2-yl]methyl]-4-oxa-6-azaspiro[2.5]octan-5-one |
| SMILES | CC(F)(F)c1cccc(-c2cncc(CN3CCC4(CC4)OC3=O)n2)c1 |
| InChI | InChI=1S/C19H19F2N3O2/c1-18(20,21)14-4-2-3-13(9-14)16-11-22-10-15(23-16)12-24-8-7-19(5-6-19)26-17(24)25/h2-4,9-11H,5-8,12H2,1H3 |
| InChIKey | AHBCQOSOOAJGBO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[[6-[3-(1,1-difluoroethyl)phenyl]pyrazin-2-yl]methyl]-4-oxa-6-azaspiro[2.5]octan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[6-[3-(1,1-difluoroethyl)phenyl]pyrazin-2-yl]methyl]-4-oxa-6-azaspiro[2.5]octan-5-one?
The IUPAC name of 6-[[6-[3-(1,1-difluoroethyl)phenyl]pyrazin-2-yl]methyl]-4-oxa-6-azaspiro[2.5]octan-5-one (CID 155386773) is 6-[[6-[3-(1,1-difluoroethyl)phenyl]pyrazin-2-yl]methyl]-4-oxa-6-azaspiro[2.5]octan-5-one.
What is the SMILES notation for 6-[[6-[3-(1,1-difluoroethyl)phenyl]pyrazin-2-yl]methyl]-4-oxa-6-azaspiro[2.5]octan-5-one?
The canonical SMILES for 6-[[6-[3-(1,1-difluoroethyl)phenyl]pyrazin-2-yl]methyl]-4-oxa-6-azaspiro[2.5]octan-5-one is CC(F)(F)c1cccc(-c2cncc(CN3CCC4(CC4)OC3=O)n2)c1.
What is the InChIKey of 6-[[6-[3-(1,1-difluoroethyl)phenyl]pyrazin-2-yl]methyl]-4-oxa-6-azaspiro[2.5]octan-5-one?
The InChIKey is AHBCQOSOOAJGBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19F2N3O2/c1-18(20,21)14-4-2-3-13(9-14)16-11-22-10-15(23-16)12-24-8-7-19(5-6-19)26-17(24)25/h2-4,9-11H,5-8,12H2,1H3.
What are the key properties of 6-[[6-[3-(1,1-difluoroethyl)phenyl]pyrazin-2-yl]methyl]-4-oxa-6-azaspiro[2.5]octan-5-one?
6-[[6-[3-(1,1-difluoroethyl)phenyl]pyrazin-2-yl]methyl]-4-oxa-6-azaspiro[2.5]octan-5-one has a molecular weight of 359.38 g/mol, XLogP of 4.13, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[6-[3-(1,1-difluoroethyl)phenyl]pyrazin-2-yl]methyl]-4-oxa-6-azaspiro[2.5]octan-5-one is sourced from PubChem (CID 155386773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).