About 2-methyl-4-pyrazolo[3,4-b]pyrazin-1-ylpyridine-3-carbonitrile
2-methyl-4-pyrazolo[3,4-b]pyrazin-1-ylpyridine-3-carbonitrile (PubChem CID 155387066) has the molecular formula C12H8N6
and a molecular weight of 236.24 g/mol. Its IUPAC name is 2-methyl-4-pyrazolo[3,4-b]pyrazin-1-ylpyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 2-methyl-4-pyrazolo[3,4-b]pyrazin-1-ylpyridine-3-carbonitrile |
| PubChem CID | 155387066 |
| Molecular Formula | C12H8N6 |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 2-methyl-4-pyrazolo[3,4-b]pyrazin-1-ylpyridine-3-carbonitrile |
| SMILES | Cc1nccc(-n2ncc3nccnc32)c1C#N |
| InChI | InChI=1S/C12H8N6/c1-8-9(6-13)11(2-3-14-8)18-12-10(7-17-18)15-4-5-16-12/h2-5,7H,1H3 |
| InChIKey | HXELVQIGILBLAM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methyl-4-pyrazolo[3,4-b]pyrazin-1-ylpyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-pyrazolo[3,4-b]pyrazin-1-ylpyridine-3-carbonitrile?
The IUPAC name of 2-methyl-4-pyrazolo[3,4-b]pyrazin-1-ylpyridine-3-carbonitrile (CID 155387066) is 2-methyl-4-pyrazolo[3,4-b]pyrazin-1-ylpyridine-3-carbonitrile.
What is the SMILES notation for 2-methyl-4-pyrazolo[3,4-b]pyrazin-1-ylpyridine-3-carbonitrile?
The canonical SMILES for 2-methyl-4-pyrazolo[3,4-b]pyrazin-1-ylpyridine-3-carbonitrile is Cc1nccc(-n2ncc3nccnc32)c1C#N.
What is the InChIKey of 2-methyl-4-pyrazolo[3,4-b]pyrazin-1-ylpyridine-3-carbonitrile?
The InChIKey is HXELVQIGILBLAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N6/c1-8-9(6-13)11(2-3-14-8)18-12-10(7-17-18)15-4-5-16-12/h2-5,7H,1H3.
What are the key properties of 2-methyl-4-pyrazolo[3,4-b]pyrazin-1-ylpyridine-3-carbonitrile?
2-methyl-4-pyrazolo[3,4-b]pyrazin-1-ylpyridine-3-carbonitrile has a molecular weight of 236.24 g/mol, XLogP of 1.39, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-pyrazolo[3,4-b]pyrazin-1-ylpyridine-3-carbonitrile is sourced from PubChem (CID 155387066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).