C12H23NO4 — CID 155387697
(2S,3S,4R,5R)-2-hexyl-4,5-dihydroxypiperidine-3-carboxylic acid (PubChem CID 155387697) has the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-hexyl-4,5-dihydroxypiperidine-3-carboxylic acid.
| Compound Name | (2S,3S,4R,5R)-2-hexyl-4,5-dihydroxypiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155387697 |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | (2S,3S,4R,5R)-2-hexyl-4,5-dihydroxypiperidine-3-carboxylic acid |
| SMILES | CCCCCC[C@@H]1NC[C@@H](O)[C@H](O)[C@H]1C(=O)O |
| InChI | InChI=1S/C12H23NO4/c1-2-3-4-5-6-8-10(12(16)17)11(15)9(14)7-13-8/h8-11,13-15H,2-7H2,1H3,(H,16,17)/t8-,9+,10-,11-/m0/s1 |
| InChIKey | RRWNAAJMVJWKAM-VLEAKVRGSA-N |
| XLogP | 0.35 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|