C15H29NO4 — CID 155387698
(2S,3S,4R,5R)-4,5-dihydroxy-2-nonylpiperidine-3-carboxylic acid (PubChem CID 155387698) has the molecular formula C15H29NO4 and a molecular weight of 287.40 g/mol. Its IUPAC name is (2S,3S,4R,5R)-4,5-dihydroxy-2-nonylpiperidine-3-carboxylic acid.
| Compound Name | (2S,3S,4R,5R)-4,5-dihydroxy-2-nonylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155387698 |
| Molecular Formula | C15H29NO4 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | (2S,3S,4R,5R)-4,5-dihydroxy-2-nonylpiperidine-3-carboxylic acid |
| SMILES | CCCCCCCCC[C@@H]1NC[C@@H](O)[C@H](O)[C@H]1C(=O)O |
| InChI | InChI=1S/C15H29NO4/c1-2-3-4-5-6-7-8-9-11-13(15(19)20)14(18)12(17)10-16-11/h11-14,16-18H,2-10H2,1H3,(H,19,20)/t11-,12+,13-,14-/m0/s1 |
| InChIKey | PFGVLKMJAGVUAN-CRWXNKLISA-N |
| XLogP | 1.52 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|