About [5-hydroxy-6-methyl-4-[N'-(3-methylsulfanylpropyl)carbamimidoyl]-3-pyridinyl]methyl dihydrogen phosphate
[5-hydroxy-6-methyl-4-[N'-(3-methylsulfanylpropyl)carbamimidoyl]-3-pyridinyl]methyl dihydrogen phosphate (PubChem CID 155387736) has the molecular formula C12H20N3O5PS
and a molecular weight of 349.35 g/mol. Its IUPAC name is [5-hydroxy-6-methyl-4-[N'-(3-methylsulfanylpropyl)carbamimidoyl]-3-pyridinyl]methyl dihydrogen phosphate.
Molecular Properties
| Compound Name | [5-hydroxy-6-methyl-4-[N'-(3-methylsulfanylpropyl)carbamimidoyl]-3-pyridinyl]methyl dihydrogen phosphate |
| PubChem CID | 155387736 |
| Molecular Formula | C12H20N3O5PS |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | [5-hydroxy-6-methyl-4-[N'-(3-methylsulfanylpropyl)carbamimidoyl]-3-pyridinyl]methyl dihydrogen phosphate |
| SMILES | CSCCC/N=C(\N)c1c(COP(=O)(O)O)cnc(C)c1O |
| InChI | InChI=1S/C12H20N3O5PS/c1-8-11(16)10(12(13)14-4-3-5-22-2)9(6-15-8)7-20-21(17,18)19/h6,16H,3-5,7H2,1-2H3,(H2,13,14)(H2,17,18,19) |
| InChIKey | YNNOTFBZTBIHHG-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 138.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [5-hydroxy-6-methyl-4-[N'-(3-methylsulfanylpropyl)carbamimidoyl]-3-pyridinyl]methyl dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-hydroxy-6-methyl-4-[N'-(3-methylsulfanylpropyl)carbamimidoyl]-3-pyridinyl]methyl dihydrogen phosphate?
The IUPAC name of [5-hydroxy-6-methyl-4-[N'-(3-methylsulfanylpropyl)carbamimidoyl]-3-pyridinyl]methyl dihydrogen phosphate (CID 155387736) is [5-hydroxy-6-methyl-4-[N'-(3-methylsulfanylpropyl)carbamimidoyl]-3-pyridinyl]methyl dihydrogen phosphate.
What is the SMILES notation for [5-hydroxy-6-methyl-4-[N'-(3-methylsulfanylpropyl)carbamimidoyl]-3-pyridinyl]methyl dihydrogen phosphate?
The canonical SMILES for [5-hydroxy-6-methyl-4-[N'-(3-methylsulfanylpropyl)carbamimidoyl]-3-pyridinyl]methyl dihydrogen phosphate is CSCCC/N=C(\N)c1c(COP(=O)(O)O)cnc(C)c1O.
What is the InChIKey of [5-hydroxy-6-methyl-4-[N'-(3-methylsulfanylpropyl)carbamimidoyl]-3-pyridinyl]methyl dihydrogen phosphate?
The InChIKey is YNNOTFBZTBIHHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N3O5PS/c1-8-11(16)10(12(13)14-4-3-5-22-2)9(6-15-8)7-20-21(17,18)19/h6,16H,3-5,7H2,1-2H3,(H2,13,14)(H2,17,18,19).
What are the key properties of [5-hydroxy-6-methyl-4-[N'-(3-methylsulfanylpropyl)carbamimidoyl]-3-pyridinyl]methyl dihydrogen phosphate?
[5-hydroxy-6-methyl-4-[N'-(3-methylsulfanylpropyl)carbamimidoyl]-3-pyridinyl]methyl dihydrogen phosphate has a molecular weight of 349.35 g/mol, XLogP of 1.16, 8 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-hydroxy-6-methyl-4-[N'-(3-methylsulfanylpropyl)carbamimidoyl]-3-pyridinyl]methyl dihydrogen phosphate is sourced from PubChem (CID 155387736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).