About 2-(1,2-dihydronaphtho[2,3-c]diazet-3-yl)naphthalen-1-amine
2-(1,2-dihydronaphtho[2,3-c]diazet-3-yl)naphthalen-1-amine (PubChem CID 155387864) has the molecular formula C20H15N3
and a molecular weight of 297.36 g/mol. Its IUPAC name is 2-(1,2-dihydronaphtho[2,3-c]diazet-3-yl)naphthalen-1-amine.
Molecular Properties
| Compound Name | 2-(1,2-dihydronaphtho[2,3-c]diazet-3-yl)naphthalen-1-amine |
| PubChem CID | 155387864 |
| Molecular Formula | C20H15N3 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-(1,2-dihydronaphtho[2,3-c]diazet-3-yl)naphthalen-1-amine |
| SMILES | Nc1c(-c2c3ccccc3cc3[nH][nH]c23)ccc2ccccc12 |
| InChI | InChI=1S/C20H15N3/c21-19-15-8-4-1-5-12(15)9-10-16(19)18-14-7-3-2-6-13(14)11-17-20(18)23-22-17/h1-11,22-23H,21H2 |
| InChIKey | RVMBOORZCZREFW-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 57.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,2-dihydronaphtho[2,3-c]diazet-3-yl)naphthalen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2-dihydronaphtho[2,3-c]diazet-3-yl)naphthalen-1-amine?
The IUPAC name of 2-(1,2-dihydronaphtho[2,3-c]diazet-3-yl)naphthalen-1-amine (CID 155387864) is 2-(1,2-dihydronaphtho[2,3-c]diazet-3-yl)naphthalen-1-amine.
What is the SMILES notation for 2-(1,2-dihydronaphtho[2,3-c]diazet-3-yl)naphthalen-1-amine?
The canonical SMILES for 2-(1,2-dihydronaphtho[2,3-c]diazet-3-yl)naphthalen-1-amine is Nc1c(-c2c3ccccc3cc3[nH][nH]c23)ccc2ccccc12.
What is the InChIKey of 2-(1,2-dihydronaphtho[2,3-c]diazet-3-yl)naphthalen-1-amine?
The InChIKey is RVMBOORZCZREFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N3/c21-19-15-8-4-1-5-12(15)9-10-16(19)18-14-7-3-2-6-13(14)11-17-20(18)23-22-17/h1-11,22-23H,21H2.
What are the key properties of 2-(1,2-dihydronaphtho[2,3-c]diazet-3-yl)naphthalen-1-amine?
2-(1,2-dihydronaphtho[2,3-c]diazet-3-yl)naphthalen-1-amine has a molecular weight of 297.36 g/mol, XLogP of 5.05, 1 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-dihydronaphtho[2,3-c]diazet-3-yl)naphthalen-1-amine is sourced from PubChem (CID 155387864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).