C20H22O3 — CID 155387871
(6aR,9S,10aR)-6,6,9-trimethyl-6a,7,8,9,10,10a-hexahydronaphtho[1,2-c]isochromene-11,12-dione (PubChem CID 155387871) has the molecular formula C20H22O3 and a molecular weight of 310.39 g/mol. Its IUPAC name is (6aR,9S,10aR)-6,6,9-trimethyl-6a,7,8,9,10,10a-hexahydronaphtho[1,2-c]isochromene-11,12-dione.
| Compound Name | (6aR,9S,10aR)-6,6,9-trimethyl-6a,7,8,9,10,10a-hexahydronaphtho[1,2-c]isochromene-11,12-dione |
|---|---|
| PubChem CID | 155387871 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | (6aR,9S,10aR)-6,6,9-trimethyl-6a,7,8,9,10,10a-hexahydronaphtho[1,2-c]isochromene-11,12-dione |
| SMILES | C[C@H]1CC[C@@H]2[C@@H](C1)C1=C(OC2(C)C)c2ccccc2C(=O)C1=O |
| InChI | InChI=1S/C20H22O3/c1-11-8-9-15-14(10-11)16-18(22)17(21)12-6-4-5-7-13(12)19(16)23-20(15,2)3/h4-7,11,14-15H,8-10H2,1-3H3/t11-,14+,15+/m0/s1 |
| InChIKey | YEINVVCCQIXMMO-NILFDRSVSA-N |
| XLogP | 4.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|