About 2-[5-(4-nitrophenyl)-2-phenyl-1H-tetrazol-1-ium-3-yl]-1,3-thiazole bromide
2-[5-(4-nitrophenyl)-2-phenyl-1H-tetrazol-1-ium-3-yl]-1,3-thiazole bromide (PubChem CID 155387910) has the molecular formula C16H13BrN6O2S
and a molecular weight of 433.29 g/mol. Its IUPAC name is 2-[5-(4-nitrophenyl)-2-phenyl-1H-tetrazol-1-ium-3-yl]-1,3-thiazole bromide.
Molecular Properties
| Compound Name | 2-[5-(4-nitrophenyl)-2-phenyl-1H-tetrazol-1-ium-3-yl]-1,3-thiazole bromide |
| PubChem CID | 155387910 |
| Molecular Formula | C16H13BrN6O2S |
| Molecular Weight | 433.29 g/mol |
| Exact Mass | 432.00 |
| IUPAC Name | 2-[5-(4-nitrophenyl)-2-phenyl-1H-tetrazol-1-ium-3-yl]-1,3-thiazole bromide |
| SMILES | O=[N+]([O-])c1ccc(C2=NN(c3nccs3)N(c3ccccc3)[NH2+]2)cc1.[Br-] |
| InChI | InChI=1S/C16H12N6O2S.BrH/c23-22(24)14-8-6-12(7-9-14)15-18-20(13-4-2-1-3-5-13)21(19-15)16-17-10-11-25-16;/h1-11H,(H,18,19);1H |
| InChIKey | TVJRPHRMWGZANW-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.29 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(4-nitrophenyl)-2-phenyl-1H-tetrazol-1-ium-3-yl]-1,3-thiazole bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(4-nitrophenyl)-2-phenyl-1H-tetrazol-1-ium-3-yl]-1,3-thiazole bromide?
The IUPAC name of 2-[5-(4-nitrophenyl)-2-phenyl-1H-tetrazol-1-ium-3-yl]-1,3-thiazole bromide (CID 155387910) is 2-[5-(4-nitrophenyl)-2-phenyl-1H-tetrazol-1-ium-3-yl]-1,3-thiazole bromide.
What is the SMILES notation for 2-[5-(4-nitrophenyl)-2-phenyl-1H-tetrazol-1-ium-3-yl]-1,3-thiazole bromide?
The canonical SMILES for 2-[5-(4-nitrophenyl)-2-phenyl-1H-tetrazol-1-ium-3-yl]-1,3-thiazole bromide is O=[N+]([O-])c1ccc(C2=NN(c3nccs3)N(c3ccccc3)[NH2+]2)cc1.[Br-].
What is the InChIKey of 2-[5-(4-nitrophenyl)-2-phenyl-1H-tetrazol-1-ium-3-yl]-1,3-thiazole bromide?
The InChIKey is TVJRPHRMWGZANW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N6O2S.BrH/c23-22(24)14-8-6-12(7-9-14)15-18-20(13-4-2-1-3-5-13)21(19-15)16-17-10-11-25-16;/h1-11H,(H,18,19);1H.
What are the key properties of 2-[5-(4-nitrophenyl)-2-phenyl-1H-tetrazol-1-ium-3-yl]-1,3-thiazole bromide?
2-[5-(4-nitrophenyl)-2-phenyl-1H-tetrazol-1-ium-3-yl]-1,3-thiazole bromide has a molecular weight of 433.29 g/mol, XLogP of -0.86, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(4-nitrophenyl)-2-phenyl-1H-tetrazol-1-ium-3-yl]-1,3-thiazole bromide is sourced from PubChem (CID 155387910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).