C41H28N4O4S2 — CID 155388041
[2-[(E)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]-4-[2-[3-[(E)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]-4-prop-2-enoyloxyphenyl]propan-2-yl]phenyl] prop-2-enoate (PubChem CID 155388041) has the molecular formula C41H28N4O4S2 and a molecular weight of 704.83 g/mol. Its IUPAC name is [2-[(E)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]-4-[2-[3-[(E)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]-4-prop-2-enoyloxyphenyl]propan-2-yl]phenyl] prop-2-enoate.
| Compound Name | [2-[(E)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]-4-[2-[3-[(E)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]-4-prop-2-enoyloxyphenyl]propan-2-yl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 155388041 |
| Molecular Formula | C41H28N4O4S2 |
| Molecular Weight | 704.83 g/mol |
| Exact Mass | 704.16 |
| IUPAC Name | [2-[(E)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]-4-[2-[3-[(E)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]-4-prop-2-enoyloxyphenyl]propan-2-yl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(C(C)(C)c2ccc(OC(=O)C=C)c(/C=C(\C#N)c3nc4ccccc4s3)c2)cc1/C=C(\C#N)c1nc2ccccc2s1 |
| InChI | InChI=1S/C41H28N4O4S2/c1-5-37(46)48-33-17-15-29(21-25(33)19-27(23-42)39-44-31-11-7-9-13-35(31)50-39)41(3,4)30-16-18-34(49-38(47)6-2)26(22-30)20-28(24-43)40-45-32-12-8-10-14-36(32)51-40/h5-22H,1-2H2,3-4H3/b27-19+,28-20+ |
| InChIKey | SHGGPZQLOVBZIZ-MKYUKRCKSA-N |
| XLogP | 9.54 |
| TPSA | 125.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.83 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|