C17H26N4O4S — CID 155388276
4-[[5-[2-(3-methyl-3-sulfanylbutanoyl)hydrazinyl]-4,6,7,8-tetrahydroquinoxalin-2-yl]oxy]butanoic acid (PubChem CID 155388276) has the molecular formula C17H26N4O4S and a molecular weight of 382.49 g/mol. Its IUPAC name is 4-[[5-[2-(3-methyl-3-sulfanylbutanoyl)hydrazinyl]-4,6,7,8-tetrahydroquinoxalin-2-yl]oxy]butanoic acid.
| Compound Name | 4-[[5-[2-(3-methyl-3-sulfanylbutanoyl)hydrazinyl]-4,6,7,8-tetrahydroquinoxalin-2-yl]oxy]butanoic acid |
|---|---|
| PubChem CID | 155388276 |
| Molecular Formula | C17H26N4O4S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 4-[[5-[2-(3-methyl-3-sulfanylbutanoyl)hydrazinyl]-4,6,7,8-tetrahydroquinoxalin-2-yl]oxy]butanoic acid |
| SMILES | CC(C)(S)CC(=O)NNC1=C2NC=C(OCCCC(=O)O)N=C2CCC1 |
| InChI | InChI=1S/C17H26N4O4S/c1-17(2,26)9-13(22)21-20-12-6-3-5-11-16(12)18-10-14(19-11)25-8-4-7-15(23)24/h10,18,20,26H,3-9H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | XZGKSGAKMHTOLN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|