C21H23F5N2O4 — CID 155389224
[1-(2,2-difluoro-5-prop-2-ynoxypentyl)-6-methyl-2-oxo-5-(2,3,6-trifluorophenyl)piperidin-3-yl]carbamic acid (PubChem CID 155389224) has the molecular formula C21H23F5N2O4 and a molecular weight of 462.42 g/mol. Its IUPAC name is [1-(2,2-difluoro-5-prop-2-ynoxypentyl)-6-methyl-2-oxo-5-(2,3,6-trifluorophenyl)piperidin-3-yl]carbamic acid.
| Compound Name | [1-(2,2-difluoro-5-prop-2-ynoxypentyl)-6-methyl-2-oxo-5-(2,3,6-trifluorophenyl)piperidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 155389224 |
| Molecular Formula | C21H23F5N2O4 |
| Molecular Weight | 462.42 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | [1-(2,2-difluoro-5-prop-2-ynoxypentyl)-6-methyl-2-oxo-5-(2,3,6-trifluorophenyl)piperidin-3-yl]carbamic acid |
| SMILES | C#CCOCCCC(F)(F)CN1C(=O)C(NC(=O)O)CC(c2c(F)ccc(F)c2F)C1C |
| InChI | InChI=1S/C21H23F5N2O4/c1-3-8-32-9-4-7-21(25,26)11-28-12(2)13(10-16(19(28)29)27-20(30)31)17-14(22)5-6-15(23)18(17)24/h1,5-6,12-13,16,27H,4,7-11H2,2H3,(H,30,31) |
| InChIKey | VBKKHSCWJFCGML-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|