About 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine
2-propan-2-yl-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine (PubChem CID 155389266) has the molecular formula C10H15NS
and a molecular weight of 181.30 g/mol. Its IUPAC name is 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine.
Molecular Properties
| Compound Name | 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine |
| PubChem CID | 155389266 |
| Molecular Formula | C10H15NS |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine |
| SMILES | CC(C)c1sc2c(c1N)CCC2 |
| InChI | InChI=1S/C10H15NS/c1-6(2)10-9(11)7-4-3-5-8(7)12-10/h6H,3-5,11H2,1-2H3 |
| InChIKey | PWDXLCDFVGVQOH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine?
The IUPAC name of 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine (CID 155389266) is 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine.
What is the SMILES notation for 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine?
The canonical SMILES for 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine is CC(C)c1sc2c(c1N)CCC2.
What is the InChIKey of 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine?
The InChIKey is PWDXLCDFVGVQOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NS/c1-6(2)10-9(11)7-4-3-5-8(7)12-10/h6H,3-5,11H2,1-2H3.
What are the key properties of 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine?
2-propan-2-yl-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine has a molecular weight of 181.30 g/mol, XLogP of 2.94, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine is sourced from PubChem (CID 155389266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).