About 2-(trifluoromethyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine;hydrochloride
2-(trifluoromethyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine;hydrochloride (PubChem CID 155389387) has the molecular formula C8H9ClF3NS
and a molecular weight of 243.68 g/mol. Its IUPAC name is 2-(trifluoromethyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine;hydrochloride.
Molecular Properties
| Compound Name | 2-(trifluoromethyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine;hydrochloride |
| PubChem CID | 155389387 |
| Molecular Formula | C8H9ClF3NS |
| Molecular Weight | 243.68 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | 2-(trifluoromethyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine;hydrochloride |
| SMILES | Cl.Nc1c(C(F)(F)F)sc2c1CCC2 |
| InChI | InChI=1S/C8H8F3NS.ClH/c9-8(10,11)7-6(12)4-2-1-3-5(4)13-7;/h1-3,12H2;1H |
| InChIKey | XZIGMEYRJGCKFT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.68 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(trifluoromethyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(trifluoromethyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine;hydrochloride?
The IUPAC name of 2-(trifluoromethyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine;hydrochloride (CID 155389387) is 2-(trifluoromethyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine;hydrochloride.
What is the SMILES notation for 2-(trifluoromethyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine;hydrochloride?
The canonical SMILES for 2-(trifluoromethyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine;hydrochloride is Cl.Nc1c(C(F)(F)F)sc2c1CCC2.
What is the InChIKey of 2-(trifluoromethyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine;hydrochloride?
The InChIKey is XZIGMEYRJGCKFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F3NS.ClH/c9-8(10,11)7-6(12)4-2-1-3-5(4)13-7;/h1-3,12H2;1H.
What are the key properties of 2-(trifluoromethyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine;hydrochloride?
2-(trifluoromethyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine;hydrochloride has a molecular weight of 243.68 g/mol, XLogP of 3.26, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(trifluoromethyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine;hydrochloride is sourced from PubChem (CID 155389387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).