C51H42N6O6 — CID 15538949
[4-[2-[4-[[4,6-bis[4-[2-(4-cyanatophenyl)propan-2-yl]phenoxy]-1,3,5-triazin-2-yl]oxy]phenyl]propan-2-yl]phenyl] cyanate (PubChem CID 15538949) has the molecular formula C51H42N6O6 and a molecular weight of 834.93 g/mol. Its IUPAC name is [4-[2-[4-[[4,6-bis[4-[2-(4-cyanatophenyl)propan-2-yl]phenoxy]-1,3,5-triazin-2-yl]oxy]phenyl]propan-2-yl]phenyl] cyanate.
| Compound Name | [4-[2-[4-[[4,6-bis[4-[2-(4-cyanatophenyl)propan-2-yl]phenoxy]-1,3,5-triazin-2-yl]oxy]phenyl]propan-2-yl]phenyl] cyanate |
|---|---|
| PubChem CID | 15538949 |
| Molecular Formula | C51H42N6O6 |
| Molecular Weight | 834.93 g/mol |
| Exact Mass | 834.32 |
| IUPAC Name | [4-[2-[4-[[4,6-bis[4-[2-(4-cyanatophenyl)propan-2-yl]phenoxy]-1,3,5-triazin-2-yl]oxy]phenyl]propan-2-yl]phenyl] cyanate |
| SMILES | CC(C)(c1ccc(OC#N)cc1)c1ccc(Oc2nc(Oc3ccc(C(C)(C)c4ccc(OC#N)cc4)cc3)nc(Oc3ccc(C(C)(C)c4ccc(OC#N)cc4)cc3)n2)cc1 |
| InChI | InChI=1S/C51H42N6O6/c1-49(2,34-7-19-40(20-8-34)58-31-52)37-13-25-43(26-14-37)61-46-55-47(62-44-27-15-38(16-28-44)50(3,4)35-9-21-41(22-10-35)59-32-53)57-48(56-46)63-45-29-17-39(18-30-45)51(5,6)36-11-23-42(24-12-36)60-33-54/h7-30H,1-6H3 |
| InChIKey | FMQXABRXDDCHKI-UHFFFAOYSA-N |
| XLogP | 11.81 |
| TPSA | 165.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.93 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|