About 2-ethyl-3-isocyanato-5,6-dihydro-4H-cyclopenta[b]thiophene
2-ethyl-3-isocyanato-5,6-dihydro-4H-cyclopenta[b]thiophene (PubChem CID 155389531) has the molecular formula C10H11NOS
and a molecular weight of 193.27 g/mol. Its IUPAC name is 2-ethyl-3-isocyanato-5,6-dihydro-4H-cyclopenta[b]thiophene.
Molecular Properties
| Compound Name | 2-ethyl-3-isocyanato-5,6-dihydro-4H-cyclopenta[b]thiophene |
| PubChem CID | 155389531 |
| Molecular Formula | C10H11NOS |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 2-ethyl-3-isocyanato-5,6-dihydro-4H-cyclopenta[b]thiophene |
| SMILES | CCc1sc2c(c1N=C=O)CCC2 |
| InChI | InChI=1S/C10H11NOS/c1-2-8-10(11-6-12)7-4-3-5-9(7)13-8/h2-5H2,1H3 |
| InChIKey | BYYQITKPHSPBRF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-3-isocyanato-5,6-dihydro-4H-cyclopenta[b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3-isocyanato-5,6-dihydro-4H-cyclopenta[b]thiophene?
The IUPAC name of 2-ethyl-3-isocyanato-5,6-dihydro-4H-cyclopenta[b]thiophene (CID 155389531) is 2-ethyl-3-isocyanato-5,6-dihydro-4H-cyclopenta[b]thiophene.
What is the SMILES notation for 2-ethyl-3-isocyanato-5,6-dihydro-4H-cyclopenta[b]thiophene?
The canonical SMILES for 2-ethyl-3-isocyanato-5,6-dihydro-4H-cyclopenta[b]thiophene is CCc1sc2c(c1N=C=O)CCC2.
What is the InChIKey of 2-ethyl-3-isocyanato-5,6-dihydro-4H-cyclopenta[b]thiophene?
The InChIKey is BYYQITKPHSPBRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NOS/c1-2-8-10(11-6-12)7-4-3-5-9(7)13-8/h2-5H2,1H3.
What are the key properties of 2-ethyl-3-isocyanato-5,6-dihydro-4H-cyclopenta[b]thiophene?
2-ethyl-3-isocyanato-5,6-dihydro-4H-cyclopenta[b]thiophene has a molecular weight of 193.27 g/mol, XLogP of 2.77, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3-isocyanato-5,6-dihydro-4H-cyclopenta[b]thiophene is sourced from PubChem (CID 155389531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).