C17H26O4 — CID 15538967
tert-butyl 9,10-dihydroxytetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate (PubChem CID 15538967) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is tert-butyl 9,10-dihydroxytetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate.
| Compound Name | tert-butyl 9,10-dihydroxytetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
|---|---|
| PubChem CID | 15538967 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | tert-butyl 9,10-dihydroxytetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CC2CC1C1C3CC(C(O)C3O)C21 |
| InChI | InChI=1S/C17H26O4/c1-17(2,3)21-16(20)9-5-7-4-8(9)13-11-6-10(12(7)13)14(18)15(11)19/h7-15,18-19H,4-6H2,1-3H3 |
| InChIKey | HHMWFJGEFJQEHQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|