C24H17F7N6O3S — CID 155390410
2-ethylsulfonyl-3-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]-7-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrazolo[1,5-a]pyrimidine (PubChem CID 155390410) has the molecular formula C24H17F7N6O3S and a molecular weight of 602.49 g/mol. Its IUPAC name is 2-ethylsulfonyl-3-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]-7-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrazolo[1,5-a]pyrimidine.
| Compound Name | 2-ethylsulfonyl-3-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]-7-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 155390410 |
| Molecular Formula | C24H17F7N6O3S |
| Molecular Weight | 602.49 g/mol |
| Exact Mass | 602.10 |
| IUPAC Name | 2-ethylsulfonyl-3-[3-methyl-6-(trifluoromethyl)imidazo[4,5-b]pyridin-2-yl]-7-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]pyrazolo[1,5-a]pyrimidine |
| SMILES | CCS(=O)(=O)c1nn2c(-c3ccc(OC(F)(F)C(F)F)cc3)ccnc2c1-c1nc2cc(C(F)(F)F)cnc2n1C |
| InChI | InChI=1S/C24H17F7N6O3S/c1-3-41(38,39)21-17(20-34-15-10-13(23(27,28)29)11-33-18(15)36(20)2)19-32-9-8-16(37(19)35-21)12-4-6-14(7-5-12)40-24(30,31)22(25)26/h4-11,22H,3H2,1-2H3 |
| InChIKey | VLZWRGDLRVXSOS-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 104.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.49 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|