C22H29ClN6O4 — CID 15539168
N-[3-(6-tert-butyl-7-chloro-5H-pyrazolo[5,1-c][1,2,4]triazol-3-yl)-2,3-dimethylbutan-2-yl]-2-(2-nitrophenoxy)acetamide (PubChem CID 15539168) has the molecular formula C22H29ClN6O4 and a molecular weight of 476.97 g/mol. Its IUPAC name is N-[3-(6-tert-butyl-7-chloro-5H-pyrazolo[5,1-c][1,2,4]triazol-3-yl)-2,3-dimethylbutan-2-yl]-2-(2-nitrophenoxy)acetamide.
| Compound Name | N-[3-(6-tert-butyl-7-chloro-5H-pyrazolo[5,1-c][1,2,4]triazol-3-yl)-2,3-dimethylbutan-2-yl]-2-(2-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 15539168 |
| Molecular Formula | C22H29ClN6O4 |
| Molecular Weight | 476.97 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | N-[3-(6-tert-butyl-7-chloro-5H-pyrazolo[5,1-c][1,2,4]triazol-3-yl)-2,3-dimethylbutan-2-yl]-2-(2-nitrophenoxy)acetamide |
| SMILES | CC(C)(C)c1[nH]n2c(C(C)(C)C(C)(C)NC(=O)COc3ccccc3[N+](=O)[O-])nnc2c1Cl |
| InChI | InChI=1S/C22H29ClN6O4/c1-20(2,3)17-16(23)18-25-26-19(28(18)27-17)21(4,5)22(6,7)24-15(30)12-33-14-11-9-8-10-13(14)29(31)32/h8-11,27H,12H2,1-7H3,(H,24,30) |
| InChIKey | HEOQDSPHTSBQFL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.97 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|