C18H15F3N2O2 — CID 155391692
2-ethyl-4-[[4-(trifluoromethyl)phenyl]methyl]indazole-3-carboxylic acid (PubChem CID 155391692) has the molecular formula C18H15F3N2O2 and a molecular weight of 348.32 g/mol. Its IUPAC name is 2-ethyl-4-[[4-(trifluoromethyl)phenyl]methyl]indazole-3-carboxylic acid.
| Compound Name | 2-ethyl-4-[[4-(trifluoromethyl)phenyl]methyl]indazole-3-carboxylic acid |
|---|---|
| PubChem CID | 155391692 |
| Molecular Formula | C18H15F3N2O2 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 2-ethyl-4-[[4-(trifluoromethyl)phenyl]methyl]indazole-3-carboxylic acid |
| SMILES | CCn1nc2cccc(Cc3ccc(C(F)(F)F)cc3)c2c1C(=O)O |
| InChI | InChI=1S/C18H15F3N2O2/c1-2-23-16(17(24)25)15-12(4-3-5-14(15)22-23)10-11-6-8-13(9-7-11)18(19,20)21/h3-9H,2,10H2,1H3,(H,24,25) |
| InChIKey | GRGLKOQFZZMTFV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |