About 6-(4-phenylphenyl)-[1,3]thiazolo[5,4-c]pyridine-2-carboxylic acid
6-(4-phenylphenyl)-[1,3]thiazolo[5,4-c]pyridine-2-carboxylic acid (PubChem CID 155391820) has the molecular formula C19H12N2O2S
and a molecular weight of 332.38 g/mol. Its IUPAC name is 6-(4-phenylphenyl)-[1,3]thiazolo[5,4-c]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-(4-phenylphenyl)-[1,3]thiazolo[5,4-c]pyridine-2-carboxylic acid |
| PubChem CID | 155391820 |
| Molecular Formula | C19H12N2O2S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 6-(4-phenylphenyl)-[1,3]thiazolo[5,4-c]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1nc2cc(-c3ccc(-c4ccccc4)cc3)ncc2s1 |
| InChI | InChI=1S/C19H12N2O2S/c22-19(23)18-21-16-10-15(20-11-17(16)24-18)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-11H,(H,22,23) |
| InChIKey | SKXROQKDSFOYLF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(4-phenylphenyl)-[1,3]thiazolo[5,4-c]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-phenylphenyl)-[1,3]thiazolo[5,4-c]pyridine-2-carboxylic acid?
The IUPAC name of 6-(4-phenylphenyl)-[1,3]thiazolo[5,4-c]pyridine-2-carboxylic acid (CID 155391820) is 6-(4-phenylphenyl)-[1,3]thiazolo[5,4-c]pyridine-2-carboxylic acid.
What is the SMILES notation for 6-(4-phenylphenyl)-[1,3]thiazolo[5,4-c]pyridine-2-carboxylic acid?
The canonical SMILES for 6-(4-phenylphenyl)-[1,3]thiazolo[5,4-c]pyridine-2-carboxylic acid is O=C(O)c1nc2cc(-c3ccc(-c4ccccc4)cc3)ncc2s1.
What is the InChIKey of 6-(4-phenylphenyl)-[1,3]thiazolo[5,4-c]pyridine-2-carboxylic acid?
The InChIKey is SKXROQKDSFOYLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12N2O2S/c22-19(23)18-21-16-10-15(20-11-17(16)24-18)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-11H,(H,22,23).
What are the key properties of 6-(4-phenylphenyl)-[1,3]thiazolo[5,4-c]pyridine-2-carboxylic acid?
6-(4-phenylphenyl)-[1,3]thiazolo[5,4-c]pyridine-2-carboxylic acid has a molecular weight of 332.38 g/mol, XLogP of 4.72, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-phenylphenyl)-[1,3]thiazolo[5,4-c]pyridine-2-carboxylic acid is sourced from PubChem (CID 155391820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).