C42H68ClN7O5 — CID 15539185
N-[2-[2-[[3-(6-tert-butyl-7-chloro-5H-pyrazolo[5,1-c][1,2,4]triazol-3-yl)-2,3-dimethylbutan-2-yl]amino]-2-oxoethoxy]phenyl]-2-hydroxy-N',N'-dioctylbutanediamide (PubChem CID 15539185) has the molecular formula C42H68ClN7O5 and a molecular weight of 786.50 g/mol. Its IUPAC name is N-[2-[2-[[3-(6-tert-butyl-7-chloro-5H-pyrazolo[5,1-c][1,2,4]triazol-3-yl)-2,3-dimethylbutan-2-yl]amino]-2-oxoethoxy]phenyl]-2-hydroxy-N',N'-dioctylbutanediamide.
| Compound Name | N-[2-[2-[[3-(6-tert-butyl-7-chloro-5H-pyrazolo[5,1-c][1,2,4]triazol-3-yl)-2,3-dimethylbutan-2-yl]amino]-2-oxoethoxy]phenyl]-2-hydroxy-N',N'-dioctylbutanediamide |
|---|---|
| PubChem CID | 15539185 |
| Molecular Formula | C42H68ClN7O5 |
| Molecular Weight | 786.50 g/mol |
| Exact Mass | 785.50 |
| IUPAC Name | N-[2-[2-[[3-(6-tert-butyl-7-chloro-5H-pyrazolo[5,1-c][1,2,4]triazol-3-yl)-2,3-dimethylbutan-2-yl]amino]-2-oxoethoxy]phenyl]-2-hydroxy-N',N'-dioctylbutanediamide |
| SMILES | CCCCCCCCN(CCCCCCCC)C(=O)CC(O)C(=O)Nc1ccccc1OCC(=O)NC(C)(C)C(C)(C)c1nnc2c(Cl)c(C(C)(C)C)[nH]n12 |
| InChI | InChI=1S/C42H68ClN7O5/c1-10-12-14-16-18-22-26-49(27-23-19-17-15-13-11-2)34(53)28-31(51)38(54)44-30-24-20-21-25-32(30)55-29-33(52)45-42(8,9)41(6,7)39-47-46-37-35(43)36(40(3,4)5)48-50(37)39/h20-21,24-25,31,48,51H,10-19,22-23,26-29H2,1-9H3,(H,44,54)(H,45,52) |
| InChIKey | YELXAKHNYHMHIC-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 153.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.50 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|