About 6-(3,3-difluorocyclobutyl)-5-fluoropyridin-3-ol
6-(3,3-difluorocyclobutyl)-5-fluoropyridin-3-ol (PubChem CID 155391972) has the molecular formula C9H8F3NO
and a molecular weight of 203.16 g/mol. Its IUPAC name is 6-(3,3-difluorocyclobutyl)-5-fluoropyridin-3-ol.
Molecular Properties
| Compound Name | 6-(3,3-difluorocyclobutyl)-5-fluoropyridin-3-ol |
| PubChem CID | 155391972 |
| Molecular Formula | C9H8F3NO |
| Molecular Weight | 203.16 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 6-(3,3-difluorocyclobutyl)-5-fluoropyridin-3-ol |
| SMILES | Oc1cnc(C2CC(F)(F)C2)c(F)c1 |
| InChI | InChI=1S/C9H8F3NO/c10-7-1-6(14)4-13-8(7)5-2-9(11,12)3-5/h1,4-5,14H,2-3H2 |
| InChIKey | LVNIXZUJJGVCPZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.16 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(3,3-difluorocyclobutyl)-5-fluoropyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,3-difluorocyclobutyl)-5-fluoropyridin-3-ol?
The IUPAC name of 6-(3,3-difluorocyclobutyl)-5-fluoropyridin-3-ol (CID 155391972) is 6-(3,3-difluorocyclobutyl)-5-fluoropyridin-3-ol.
What is the SMILES notation for 6-(3,3-difluorocyclobutyl)-5-fluoropyridin-3-ol?
The canonical SMILES for 6-(3,3-difluorocyclobutyl)-5-fluoropyridin-3-ol is Oc1cnc(C2CC(F)(F)C2)c(F)c1.
What is the InChIKey of 6-(3,3-difluorocyclobutyl)-5-fluoropyridin-3-ol?
The InChIKey is LVNIXZUJJGVCPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F3NO/c10-7-1-6(14)4-13-8(7)5-2-9(11,12)3-5/h1,4-5,14H,2-3H2.
What are the key properties of 6-(3,3-difluorocyclobutyl)-5-fluoropyridin-3-ol?
6-(3,3-difluorocyclobutyl)-5-fluoropyridin-3-ol has a molecular weight of 203.16 g/mol, XLogP of 2.44, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,3-difluorocyclobutyl)-5-fluoropyridin-3-ol is sourced from PubChem (CID 155391972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).