About 2,2-diethoxy-N'-[[4-(trifluoromethyl)phenyl]methyl]ethanimidamide
2,2-diethoxy-N'-[[4-(trifluoromethyl)phenyl]methyl]ethanimidamide (PubChem CID 155392006) has the molecular formula C14H19F3N2O2
and a molecular weight of 304.31 g/mol. Its IUPAC name is 2,2-diethoxy-N'-[[4-(trifluoromethyl)phenyl]methyl]ethanimidamide.
Molecular Properties
| Compound Name | 2,2-diethoxy-N'-[[4-(trifluoromethyl)phenyl]methyl]ethanimidamide |
| PubChem CID | 155392006 |
| Molecular Formula | C14H19F3N2O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 2,2-diethoxy-N'-[[4-(trifluoromethyl)phenyl]methyl]ethanimidamide |
| SMILES | CCOC(OCC)/C(N)=N/Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H19F3N2O2/c1-3-20-13(21-4-2)12(18)19-9-10-5-7-11(8-6-10)14(15,16)17/h5-8,13H,3-4,9H2,1-2H3,(H2,18,19) |
| InChIKey | IGGRHDCQFCZIIO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2,2-diethoxy-N'-[[4-(trifluoromethyl)phenyl]methyl]ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethoxy-N'-[[4-(trifluoromethyl)phenyl]methyl]ethanimidamide?
The IUPAC name of 2,2-diethoxy-N'-[[4-(trifluoromethyl)phenyl]methyl]ethanimidamide (CID 155392006) is 2,2-diethoxy-N'-[[4-(trifluoromethyl)phenyl]methyl]ethanimidamide.
What is the SMILES notation for 2,2-diethoxy-N'-[[4-(trifluoromethyl)phenyl]methyl]ethanimidamide?
The canonical SMILES for 2,2-diethoxy-N'-[[4-(trifluoromethyl)phenyl]methyl]ethanimidamide is CCOC(OCC)/C(N)=N/Cc1ccc(C(F)(F)F)cc1.
What is the InChIKey of 2,2-diethoxy-N'-[[4-(trifluoromethyl)phenyl]methyl]ethanimidamide?
The InChIKey is IGGRHDCQFCZIIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19F3N2O2/c1-3-20-13(21-4-2)12(18)19-9-10-5-7-11(8-6-10)14(15,16)17/h5-8,13H,3-4,9H2,1-2H3,(H2,18,19).
What are the key properties of 2,2-diethoxy-N'-[[4-(trifluoromethyl)phenyl]methyl]ethanimidamide?
2,2-diethoxy-N'-[[4-(trifluoromethyl)phenyl]methyl]ethanimidamide has a molecular weight of 304.31 g/mol, XLogP of 2.96, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethoxy-N'-[[4-(trifluoromethyl)phenyl]methyl]ethanimidamide is sourced from PubChem (CID 155392006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).