C29H26N2O4S — CID 155392012
[1-ethyl-6-(3-methylsulfonylphenoxy)benzimidazol-2-yl]-diphenylmethanol (PubChem CID 155392012) has the molecular formula C29H26N2O4S and a molecular weight of 498.60 g/mol. Its IUPAC name is [1-ethyl-6-(3-methylsulfonylphenoxy)benzimidazol-2-yl]-diphenylmethanol.
| Compound Name | [1-ethyl-6-(3-methylsulfonylphenoxy)benzimidazol-2-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 155392012 |
| Molecular Formula | C29H26N2O4S |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | [1-ethyl-6-(3-methylsulfonylphenoxy)benzimidazol-2-yl]-diphenylmethanol |
| SMILES | CCn1c(C(O)(c2ccccc2)c2ccccc2)nc2ccc(Oc3cccc(S(C)(=O)=O)c3)cc21 |
| InChI | InChI=1S/C29H26N2O4S/c1-3-31-27-20-24(35-23-15-10-16-25(19-23)36(2,33)34)17-18-26(27)30-28(31)29(32,21-11-6-4-7-12-21)22-13-8-5-9-14-22/h4-20,32H,3H2,1-2H3 |
| InChIKey | DABLDTUPUCQDQQ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |