C18H12F3NO2 — CID 155392104
2-methyl-3-[[5-(trifluoromethyl)-2-pyridinyl]methyl]naphthalene-1,4-dione (PubChem CID 155392104) has the molecular formula C18H12F3NO2 and a molecular weight of 331.29 g/mol. Its IUPAC name is 2-methyl-3-[[5-(trifluoromethyl)-2-pyridinyl]methyl]naphthalene-1,4-dione.
| Compound Name | 2-methyl-3-[[5-(trifluoromethyl)-2-pyridinyl]methyl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 155392104 |
| Molecular Formula | C18H12F3NO2 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 2-methyl-3-[[5-(trifluoromethyl)-2-pyridinyl]methyl]naphthalene-1,4-dione |
| SMILES | CC1=C(Cc2ccc(C(F)(F)F)cn2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H12F3NO2/c1-10-15(8-12-7-6-11(9-22-12)18(19,20)21)17(24)14-5-3-2-4-13(14)16(10)23/h2-7,9H,8H2,1H3 |
| InChIKey | GDENDYRDMCSOLC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|