About cyclopropyl 6-acetyloxy-2,2-diphenylbenzo[h]chromene-5-carboxylate
cyclopropyl 6-acetyloxy-2,2-diphenylbenzo[h]chromene-5-carboxylate (PubChem CID 15539229) has the molecular formula C31H24O5
and a molecular weight of 476.53 g/mol. Its IUPAC name is cyclopropyl 6-acetyloxy-2,2-diphenylbenzo[h]chromene-5-carboxylate.
Molecular Properties
| Compound Name | cyclopropyl 6-acetyloxy-2,2-diphenylbenzo[h]chromene-5-carboxylate |
| PubChem CID | 15539229 |
| Molecular Formula | C31H24O5 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | cyclopropyl 6-acetyloxy-2,2-diphenylbenzo[h]chromene-5-carboxylate |
| SMILES | CC(=O)Oc1c(C(=O)OC2CC2)c2c(c3ccccc13)OC(c1ccccc1)(c1ccccc1)C=C2 |
| InChI | InChI=1S/C31H24O5/c1-20(32)34-29-25-15-9-8-14-24(25)28-26(27(29)30(33)35-23-16-17-23)18-19-31(36-28,21-10-4-2-5-11-21)22-12-6-3-7-13-22/h2-15,18-19,23H,16-17H2,1H3 |
| InChIKey | KKHXLUNCCAFHFB-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze cyclopropyl 6-acetyloxy-2,2-diphenylbenzo[h]chromene-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl 6-acetyloxy-2,2-diphenylbenzo[h]chromene-5-carboxylate?
The IUPAC name of cyclopropyl 6-acetyloxy-2,2-diphenylbenzo[h]chromene-5-carboxylate (CID 15539229) is cyclopropyl 6-acetyloxy-2,2-diphenylbenzo[h]chromene-5-carboxylate.
What is the SMILES notation for cyclopropyl 6-acetyloxy-2,2-diphenylbenzo[h]chromene-5-carboxylate?
The canonical SMILES for cyclopropyl 6-acetyloxy-2,2-diphenylbenzo[h]chromene-5-carboxylate is CC(=O)Oc1c(C(=O)OC2CC2)c2c(c3ccccc13)OC(c1ccccc1)(c1ccccc1)C=C2.
What is the InChIKey of cyclopropyl 6-acetyloxy-2,2-diphenylbenzo[h]chromene-5-carboxylate?
The InChIKey is KKHXLUNCCAFHFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H24O5/c1-20(32)34-29-25-15-9-8-14-24(25)28-26(27(29)30(33)35-23-16-17-23)18-19-31(36-28,21-10-4-2-5-11-21)22-12-6-3-7-13-22/h2-15,18-19,23H,16-17H2,1H3.
What are the key properties of cyclopropyl 6-acetyloxy-2,2-diphenylbenzo[h]chromene-5-carboxylate?
cyclopropyl 6-acetyloxy-2,2-diphenylbenzo[h]chromene-5-carboxylate has a molecular weight of 476.53 g/mol, XLogP of 6.43, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl 6-acetyloxy-2,2-diphenylbenzo[h]chromene-5-carboxylate is sourced from PubChem (CID 15539229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).