C24H27FN8O2S — CID 155392418
ethyl 2-[[4-[(1S,4R,5R,7R)-5-amino-7-methyl-2-azabicyclo[2.2.1]heptan-2-yl]-6-fluoro-8-(methylamino)-9H-pyrimido[4,5-b]indol-2-yl]amino]-1,3-thiazole-4-carboxylate (PubChem CID 155392418) has the molecular formula C24H27FN8O2S and a molecular weight of 510.60 g/mol. Its IUPAC name is ethyl 2-[[4-[(1S,4R,5R,7R)-5-amino-7-methyl-2-azabicyclo[2.2.1]heptan-2-yl]-6-fluoro-8-(methylamino)-9H-pyrimido[4,5-b]indol-2-yl]amino]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[[4-[(1S,4R,5R,7R)-5-amino-7-methyl-2-azabicyclo[2.2.1]heptan-2-yl]-6-fluoro-8-(methylamino)-9H-pyrimido[4,5-b]indol-2-yl]amino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 155392418 |
| Molecular Formula | C24H27FN8O2S |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | ethyl 2-[[4-[(1S,4R,5R,7R)-5-amino-7-methyl-2-azabicyclo[2.2.1]heptan-2-yl]-6-fluoro-8-(methylamino)-9H-pyrimido[4,5-b]indol-2-yl]amino]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(Nc2nc(N3C[C@H]4[C@@H](C)[C@@H]3C[C@H]4N)c3c(n2)[nH]c2c(NC)cc(F)cc23)n1 |
| InChI | InChI=1S/C24H27FN8O2S/c1-4-35-22(34)16-9-36-24(28-16)32-23-30-20-18(12-5-11(25)6-15(27-3)19(12)29-20)21(31-23)33-8-13-10(2)17(33)7-14(13)26/h5-6,9-10,13-14,17,27H,4,7-8,26H2,1-3H3,(H2,28,29,30,31,32)/t10-,13+,14-,17+/m1/s1 |
| InChIKey | QVLIDEDVFKIREO-NSOAYMTKSA-N |
| XLogP | 3.84 |
| TPSA | 134.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |