C10H12O3 — CID 15539244
(3R,6aS)-3-prop-2-enoxy-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one (PubChem CID 15539244) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is (3R,6aS)-3-prop-2-enoxy-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one.
| Compound Name | (3R,6aS)-3-prop-2-enoxy-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one |
|---|---|
| PubChem CID | 15539244 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | (3R,6aS)-3-prop-2-enoxy-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one |
| SMILES | C=CCO[C@@H]1OC[C@H]2CC(=O)C=C21 |
| InChI | InChI=1S/C10H12O3/c1-2-3-12-10-9-5-8(11)4-7(9)6-13-10/h2,5,7,10H,1,3-4,6H2/t7-,10-/m1/s1 |
| InChIKey | KFYGVXLIVNJRTQ-GMSGAONNSA-N |
| XLogP | 1.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|