C10H15N5O4PS+ — CID 155392757
[(2S,5R)-5-(2-amino-6-oxo-2,3-dihydro-1H-purin-9-yl)oxolan-2-yl]methoxy-oxo-sulfanylphosphanium (PubChem CID 155392757) has the molecular formula C10H15N5O4PS+ and a molecular weight of 332.30 g/mol. Its IUPAC name is [(2S,5R)-5-(2-amino-6-oxo-2,3-dihydro-1H-purin-9-yl)oxolan-2-yl]methoxy-oxo-sulfanylphosphanium.
| Compound Name | [(2S,5R)-5-(2-amino-6-oxo-2,3-dihydro-1H-purin-9-yl)oxolan-2-yl]methoxy-oxo-sulfanylphosphanium |
|---|---|
| PubChem CID | 155392757 |
| Molecular Formula | C10H15N5O4PS+ |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | [(2S,5R)-5-(2-amino-6-oxo-2,3-dihydro-1H-purin-9-yl)oxolan-2-yl]methoxy-oxo-sulfanylphosphanium |
| SMILES | NC1NC(=O)c2ncn([C@H]3CC[C@@H](CO[P+](=O)S)O3)c2N1 |
| InChI | InChI=1S/C10H14N5O4PS/c11-10-13-8-7(9(16)14-10)12-4-15(8)6-2-1-5(19-6)3-18-20(17)21/h4-6,10H,1-3,11H2,(H2-,13,14,16,17,21)/p+1/t5-,6+,10?/m0/s1 |
| InChIKey | ASXPKDYDDRQCSV-HIJFXMFQSA-O |
| XLogP | 0.56 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|