C14H21FN2O — CID 155393144
1-[4-[(3E,5E)-6-fluorohexa-1,3,5-trien-3-yl]piperazin-1-yl]butan-1-one (PubChem CID 155393144) has the molecular formula C14H21FN2O and a molecular weight of 252.33 g/mol. Its IUPAC name is 1-[4-[(3E,5E)-6-fluorohexa-1,3,5-trien-3-yl]piperazin-1-yl]butan-1-one.
| Compound Name | 1-[4-[(3E,5E)-6-fluorohexa-1,3,5-trien-3-yl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 155393144 |
| Molecular Formula | C14H21FN2O |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 1-[4-[(3E,5E)-6-fluorohexa-1,3,5-trien-3-yl]piperazin-1-yl]butan-1-one |
| SMILES | C=C/C(=C\C=C\F)N1CCN(C(=O)CCC)CC1 |
| InChI | InChI=1S/C14H21FN2O/c1-3-6-14(18)17-11-9-16(10-12-17)13(4-2)7-5-8-15/h4-5,7-8H,2-3,6,9-12H2,1H3/b8-5+,13-7+ |
| InChIKey | KNNNBBMEAKYVDP-SRLAFUIXSA-N |
| XLogP | 2.48 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|