C23H34N2 — CID 155394536
N,N'-bis(2,6-dimethylphenyl)-N,N',2,2-tetramethylpropane-1,3-diamine (PubChem CID 155394536) has the molecular formula C23H34N2 and a molecular weight of 338.54 g/mol. Its IUPAC name is N,N'-bis(2,6-dimethylphenyl)-N,N',2,2-tetramethylpropane-1,3-diamine.
| Compound Name | N,N'-bis(2,6-dimethylphenyl)-N,N',2,2-tetramethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 155394536 |
| Molecular Formula | C23H34N2 |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.27 |
| IUPAC Name | N,N'-bis(2,6-dimethylphenyl)-N,N',2,2-tetramethylpropane-1,3-diamine |
| SMILES | Cc1cccc(C)c1N(C)CC(C)(C)CN(C)c1c(C)cccc1C |
| InChI | InChI=1S/C23H34N2/c1-17-11-9-12-18(2)21(17)24(7)15-23(5,6)16-25(8)22-19(3)13-10-14-20(22)4/h9-14H,15-16H2,1-8H3 |
| InChIKey | KWLHUUHIUQGVES-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |