C16H25FN2 — CID 155394910
N-[(E)-2-fluoro-1-(methylideneamino)but-1-enyl]-N,4-dimethyl-2-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine (PubChem CID 155394910) has the molecular formula C16H25FN2 and a molecular weight of 264.39 g/mol. Its IUPAC name is N-[(E)-2-fluoro-1-(methylideneamino)but-1-enyl]-N,4-dimethyl-2-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine.
| Compound Name | N-[(E)-2-fluoro-1-(methylideneamino)but-1-enyl]-N,4-dimethyl-2-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 155394910 |
| Molecular Formula | C16H25FN2 |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | N-[(E)-2-fluoro-1-(methylideneamino)but-1-enyl]-N,4-dimethyl-2-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine |
| SMILES | C=CC(C)=CC(/C=C\C)CN(C)/C(N=C)=C(\F)CC |
| InChI | InChI=1S/C16H25FN2/c1-7-10-14(11-13(4)8-2)12-19(6)16(18-5)15(17)9-3/h7-8,10-11,14H,2,5,9,12H2,1,3-4,6H3/b10-7-,13-11?,16-15- |
| InChIKey | ADTNZOUPMTWNAC-KXONVBOOSA-N |
| XLogP | 4.49 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|