C30H20Cl2N6O — CID 155394986
4-[5-(3-aminophenyl)-3-chloro-1H-pyrrolo[2,3-b]pyridin-2-yl]-N-[3-(3-chloro-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]but-2-ynamide (PubChem CID 155394986) has the molecular formula C30H20Cl2N6O and a molecular weight of 551.44 g/mol. Its IUPAC name is 4-[5-(3-aminophenyl)-3-chloro-1H-pyrrolo[2,3-b]pyridin-2-yl]-N-[3-(3-chloro-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]but-2-ynamide.
| Compound Name | 4-[5-(3-aminophenyl)-3-chloro-1H-pyrrolo[2,3-b]pyridin-2-yl]-N-[3-(3-chloro-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]but-2-ynamide |
|---|---|
| PubChem CID | 155394986 |
| Molecular Formula | C30H20Cl2N6O |
| Molecular Weight | 551.44 g/mol |
| Exact Mass | 550.11 |
| IUPAC Name | 4-[5-(3-aminophenyl)-3-chloro-1H-pyrrolo[2,3-b]pyridin-2-yl]-N-[3-(3-chloro-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]but-2-ynamide |
| SMILES | Nc1cccc(-c2cnc3[nH]c(CC#CC(=O)Nc4cccc(-c5cnc6[nH]cc(Cl)c6c5)c4)c(Cl)c3c2)c1 |
| InChI | InChI=1S/C30H20Cl2N6O/c31-25-16-36-29-23(25)12-19(14-34-29)18-5-2-7-22(11-18)37-27(39)9-3-8-26-28(32)24-13-20(15-35-30(24)38-26)17-4-1-6-21(33)10-17/h1-2,4-7,10-16H,8,33H2,(H,34,36)(H,35,38)(H,37,39) |
| InChIKey | SBTNSXNNHMQOLA-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.44 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|