About 2-[[4-[6-(N-cyclohexa-1,5-dien-1-ylanilino)pyrazin-2-yl]cyclohexyl]methoxy]acetic acid
2-[[4-[6-(N-cyclohexa-1,5-dien-1-ylanilino)pyrazin-2-yl]cyclohexyl]methoxy]acetic acid (PubChem CID 155395293) has the molecular formula C25H29N3O3
and a molecular weight of 419.53 g/mol. Its IUPAC name is 2-[[4-[6-(N-cyclohexa-1,5-dien-1-ylanilino)pyrazin-2-yl]cyclohexyl]methoxy]acetic acid.
Molecular Properties
| Compound Name | 2-[[4-[6-(N-cyclohexa-1,5-dien-1-ylanilino)pyrazin-2-yl]cyclohexyl]methoxy]acetic acid |
| PubChem CID | 155395293 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 2-[[4-[6-(N-cyclohexa-1,5-dien-1-ylanilino)pyrazin-2-yl]cyclohexyl]methoxy]acetic acid |
| SMILES | O=C(O)COCC1CCC(c2cncc(N(C3=CCCC=C3)c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C25H29N3O3/c29-25(30)18-31-17-19-11-13-20(14-12-19)23-15-26-16-24(27-23)28(21-7-3-1-4-8-21)22-9-5-2-6-10-22/h1,3-5,7-10,15-16,19-20H,2,6,11-14,17-18H2,(H,29,30) |
| InChIKey | ZOEWRZIBEAKGJK-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[4-[6-(N-cyclohexa-1,5-dien-1-ylanilino)pyrazin-2-yl]cyclohexyl]methoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-[6-(N-cyclohexa-1,5-dien-1-ylanilino)pyrazin-2-yl]cyclohexyl]methoxy]acetic acid?
The IUPAC name of 2-[[4-[6-(N-cyclohexa-1,5-dien-1-ylanilino)pyrazin-2-yl]cyclohexyl]methoxy]acetic acid (CID 155395293) is 2-[[4-[6-(N-cyclohexa-1,5-dien-1-ylanilino)pyrazin-2-yl]cyclohexyl]methoxy]acetic acid.
What is the SMILES notation for 2-[[4-[6-(N-cyclohexa-1,5-dien-1-ylanilino)pyrazin-2-yl]cyclohexyl]methoxy]acetic acid?
The canonical SMILES for 2-[[4-[6-(N-cyclohexa-1,5-dien-1-ylanilino)pyrazin-2-yl]cyclohexyl]methoxy]acetic acid is O=C(O)COCC1CCC(c2cncc(N(C3=CCCC=C3)c3ccccc3)n2)CC1.
What is the InChIKey of 2-[[4-[6-(N-cyclohexa-1,5-dien-1-ylanilino)pyrazin-2-yl]cyclohexyl]methoxy]acetic acid?
The InChIKey is ZOEWRZIBEAKGJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29N3O3/c29-25(30)18-31-17-19-11-13-20(14-12-19)23-15-26-16-24(27-23)28(21-7-3-1-4-8-21)22-9-5-2-6-10-22/h1,3-5,7-10,15-16,19-20H,2,6,11-14,17-18H2,(H,29,30).
What are the key properties of 2-[[4-[6-(N-cyclohexa-1,5-dien-1-ylanilino)pyrazin-2-yl]cyclohexyl]methoxy]acetic acid?
2-[[4-[6-(N-cyclohexa-1,5-dien-1-ylanilino)pyrazin-2-yl]cyclohexyl]methoxy]acetic acid has a molecular weight of 419.53 g/mol, XLogP of 5.22, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-[6-(N-cyclohexa-1,5-dien-1-ylanilino)pyrazin-2-yl]cyclohexyl]methoxy]acetic acid is sourced from PubChem (CID 155395293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).