C20H31FO2 — CID 155395414
(3S,5R,8S,10R,13S)-10-fluoro-3-(methoxymethyl)-13-methyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 155395414) has the molecular formula C20H31FO2 and a molecular weight of 322.46 g/mol. Its IUPAC name is (3S,5R,8S,10R,13S)-10-fluoro-3-(methoxymethyl)-13-methyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (3S,5R,8S,10R,13S)-10-fluoro-3-(methoxymethyl)-13-methyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 155395414 |
| Molecular Formula | C20H31FO2 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | (3S,5R,8S,10R,13S)-10-fluoro-3-(methoxymethyl)-13-methyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | COC[C@H]1CC[C@]2(F)C3CC[C@]4(C)C(=O)CCC4[C@@H]3CC[C@@H]2C1 |
| InChI | InChI=1S/C20H31FO2/c1-19-9-8-17-15(16(19)5-6-18(19)22)4-3-14-11-13(12-23-2)7-10-20(14,17)21/h13-17H,3-12H2,1-2H3/t13-,14+,15-,16?,17?,19-,20+/m0/s1 |
| InChIKey | XSKHLQSKLDYLPR-BPJKFUDMSA-N |
| XLogP | 4.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |